* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-Boc-4-ethyl-DL-phenylalanine |
CAS: | 110762-15-7 |
English Synonyms: | N-BOC-4-ETHYL-DL-PHENYLALANINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)NC(CC1=CC=C(C=C1)CC)C(=O)O |
InChi: | InChI=1S/C16H23NO4/c1-5-11-6-8-12(9-7-11)10-13(14(18)19)17-15(20)21-16(2,3)4/h6-9,13H,5,10H2,1-4H3,(H,17,20)(H,18,19) |
InChiKey: | InChIKey=IDBBFXLHABOKHF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.