* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | N-FORMYLUREA |
CAS: | 1190-24-5 |
English Synonyms: | N-FORMYLUREA ; FORMYLUREA |
MDL Number.: | MFCD00039769 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C(=O)NC(=O)N |
InChi: | InChI=1S/C2H4N2O2/c3-2(6)4-1-5/h1H,(H3,3,4,5,6) |
InChiKey: | InChIKey=JOWMUPQBELRFRZ-UHFFFAOYSA-N |
|
|
Melting Point: | 168-170 DEG C |
Comments: | BRN: 1745350 EINECS: 214-719-4 TSCA: N UNSPSC: 12352111 |
|
* If the product has intellectual property rights, a license granted is must or contact us.