* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDAZOLE, 6-CHLORO-1-HYDROXY- |
CAS: | 1193266-37-3 |
English Synonyms: | INDAZOLE, 6-CHLORO-1-HYDROXY- |
MDL Number.: | MFCD17010090 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2cnn(c2cc1Cl)O |
InChi: | InChI=1S/C7H5ClN2O/c8-6-2-1-5-4-9-10(11)7(5)3-6/h1-4,11H |
InChiKey: | InChIKey=LRHRLAYEENECFT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.