* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INDAZOLE, 4-FLUORO-1-HYDROXY- |
| CAS: | 1193266-41-9 |
| English Synonyms: | INDAZOLE, 4-FLUORO-1-HYDROXY- |
| MDL Number.: | MFCD17010091 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc2c(cnn2O)c(c1)F |
| InChi: | InChI=1S/C7H5FN2O/c8-6-2-1-3-7-5(6)4-9-10(7)11/h1-4,11H |
| InChiKey: | InChIKey=VVZNLODKPADBHP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.