* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BOC-7-METHYL-DL-TRYPTOPHAN |
| CAS: | 1219333-83-1 |
| English Synonyms: | BOC-7-METHYL-DL-TRYPTOPHAN |
| MDL Number.: | MFCD02682378 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | Cc1cccc2c1[nH]cc2CC(C(=O)O)NC(=O)OC(C)(C)C |
| InChi: | InChI=1S/C17H22N2O4/c1-10-6-5-7-12-11(9-18-14(10)12)8-13(15(20)21)19-16(22)23-17(2,3)4/h5-7,9,13,18H,8H2,1-4H3,(H,19,22)(H,20,21) |
| InChiKey: | InChIKey=JCBJFQWNCYKIEX-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.