* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,4-DICHLOROOXAZOLE |
CAS: | 1240603-50-2 |
English Synonyms: | 2,4-DICHLOROOXAZOLE |
MDL Number.: | MFCD16989395 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1c(nc(o1)Cl)Cl |
InChi: | InChI=1S/C3HCl2NO/c4-2-1-7-3(5)6-2/h1H |
InChiKey: | InChIKey=XSACQZSHYVDIBA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.