* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-PENTEN-2-ONE, 4-(2-PROPENYLAMINO)- |
CAS: | 124747-44-0 ;221526-35-8 |
English Synonyms: | 3-PENTEN-2-ONE, 4-(2-PROPENYLAMINO)- ; 3-PENTEN-2-ONE, 4-(2-PROPENYLAMINO)-, (3Z)- ; 4-(2-PROPENYLAMINO)-3-PENTEN-2-ONE |
MDL Number.: | MFCD18829316 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C(=C/C(=O)C)/NCC=C |
InChi: | InChI=1S/C8H13NO/c1-4-5-9-7(2)6-8(3)10/h4,6,9H,1,5H2,2-3H3/b7-6- |
InChiKey: | InChIKey=HFSKCDLINDPYLL-SREVYHEPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.