* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-9H-CARBAZOLE |
| CAS: | 1255309-13-7 |
| English Synonyms: | 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-CARBAZOLE ; 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-9H-CARBAZOLE |
| MDL Number.: | MFCD16996079 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cccc3c2c4ccccc4[nH]3 |
| InChi: | InChI=1S/C18H20BNO2/c1-17(2)18(3,4)22-19(21-17)13-9-7-11-15-16(13)12-8-5-6-10-14(12)20-15/h5-11,20H,1-4H3 |
| InChiKey: | InChIKey=BLFDNIPIBSFUEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.