* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | PIMARIC ACID |
CAS: | 127-27-5 |
English Synonyms: | PIMARIC ACID |
MDL Number.: | MFCD01632486 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C[C@@H]1CC[C@H]2C(=C1)CC[C@@H]3[C@@]2(CCC[C@@]3(C)C(=O)O)C |
InChi: | InChI=1S/C18H28O2/c1-12-5-7-14-13(11-12)6-8-15-17(14,2)9-4-10-18(15,3)16(19)20/h11-12,14-15H,4-10H2,1-3H3,(H,19,20)/t12-,14+,15-,17-,18-/m1/s1 |
InChiKey: | InChIKey=AQMKARDJTJSPIX-BPSIQINWSA-N |
|
|
Density: | DENSITY: 1.65 |
|
* If the product has intellectual property rights, a license granted is must or contact us.