* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-VINYL-9-BORABICYCLO3.3.1NONANE |
CAS: | 129493-14-7 |
English Synonyms: | 9-VINYL-9-BORABICYCLO3.3.1NONANE |
MDL Number.: | MFCD16876415 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | B1([C@@H]2CCC[C@H]1CCC2)C=C |
InChi: | InChI=1S/C10H17B/c1-2-11-9-5-3-6-10(11)8-4-7-9/h2,9-10H,1,3-8H2/t9-,10+ |
InChiKey: | InChIKey=BXPGUGQBTYHODY-AOOOYVTPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.