* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ALAZOPEPTIN |
| CAS: | 1397-84-8 |
| English Synonyms: | ALAZOPEPTIN |
| MDL Number.: | MFCD01674463 |
| H bond acceptor: | 11 |
| H bond donor: | 3 |
| Smile: | C=CCN[C@@H](CCC(=O)C=[N+]=[N-])C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)O |
| InChi: | InChI=1S/C15H20N6O5/c1-2-7-18-12(5-3-10(22)8-19-16)14(24)21-13(15(25)26)6-4-11(23)9-20-17/h2,8-9,12-13,18H,1,3-7H2,(H,21,24)(H,25,26)/t12-,13-/m0/s1 |
| InChiKey: | InChIKey=LYUGICBKRYXVHJ-STQMWFEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.