* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (1R)-1-(2-FURANYL-)-1,2-ETHANEDIOL |
CAS: | 14086-08-9 |
English Synonyms: | (1R)-1-(2-FURANYL-)-1,2-ETHANEDIOL |
MDL Number.: | MFCD15145912 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc(oc1)[C@@H](CO)O |
InChi: | InChI=1S/C6H8O3/c7-4-5(8)6-2-1-3-9-6/h1-3,5,7-8H,4H2/t5-/m1/s1 |
InChiKey: | InChIKey=YOSOKWRRCVPEJS-RXMQYKEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.