* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDISETRON |
CAS: | 141549-75-9 |
English Synonyms: | INDISETRON |
MDL Number.: | MFCD09837689 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CN1C[C@H]2C[C@H](C[C@@H](C1)N2C)NC(=O)c3c4ccccc4[nH]n3 |
InChi: | InChI=1S/C17H23N5O/c1-21-9-12-7-11(8-13(10-21)22(12)2)18-17(23)16-14-5-3-4-6-15(14)19-20-16/h3-6,11-13H,7-10H2,1-2H3,(H,18,23)(H,19,20)/t11-,12-,13+ |
InChiKey: | InChIKey=MHNNVDILNTUWNS-XYYAHUGASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.