* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-D-VAL-LYS(Z)-OH |
| CAS: | 1436-71-1 |
| English Synonyms: | Z-D-VAL-LYS(Z)-OH |
| MDL Number.: | MFCD00057796 |
| H bond acceptor: | 10 |
| H bond donor: | 4 |
| Smile: | CC(C)[C@H](C(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)O)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C27H35N3O7/c1-19(2)23(30-27(35)37-18-21-13-7-4-8-14-21)24(31)29-22(25(32)33)15-9-10-16-28-26(34)36-17-20-11-5-3-6-12-20/h3-8,11-14,19,22-23H,9-10,15-18H2,1-2H3,(H,28,34)(H,29,31)(H,30,35)(H,32,33)/t22-,23+/m0/s1 |
| InChiKey: | InChIKey=WVSBQFKNHQTXCY-XZOQPEGZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.