* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | AZIMILIDE |
| CAS: | 149908-53-2 |
| English Synonyms: | AZIMILIDE |
| MDL Number.: | MFCD00867099 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | CN1CCN(CC1)CCCCN2C(=O)CN(C2=O)/N=C/c3ccc(o3)c4ccc(cc4)Cl |
| InChi: | InChI=1S/C23H28ClN5O3/c1-26-12-14-27(15-13-26)10-2-3-11-28-22(30)17-29(23(28)31)25-16-20-8-9-21(32-20)18-4-6-19(24)7-5-18/h4-9,16H,2-3,10-15,17H2,1H3/b25-16+ |
| InChiKey: | InChIKey=MREBEPTUUMTTIA-PCLIKHOPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.