* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-Cyano-3-(thiazol-2-yl)acrylic acid |
CAS: | 1567534-28-4 |
English Synonyms: | 2-CYANO-3-(THIAZOL-2-YL)ACRYLIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(#N)C(C(=O)O)=CC=1SC=CN1 |
InChi: | InChI=1S/C7H4N2O2S/c8-4-5(7(10)11)3-6-9-1-2-12-6/h1-3H,(H,10,11) |
InChiKey: | InChIKey=JAHDBRAKMOMJIV-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.