* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-AMINOCROTONAMIDE |
CAS: | 15846-25-0 |
English Synonyms: | (2E)-3-AMINOBUT-2-ENAMIDE ; 3-AMINOCROTONAMIDE |
MDL Number.: | MFCD00014810 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C/C(=C\C(=O)N)/N |
InChi: | InChI=1S/C4H8N2O/c1-3(5)2-4(6)7/h2H,5H2,1H3,(H2,6,7)/b3-2+ |
InChiKey: | InChIKey=UAUSQEVPWPGBHG-NSCUHMNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.