* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINACILLIN |
| CAS: | 1596-63-0 |
| English Synonyms: | QUINACILLIN |
| MDL Number.: | MFCD00865014 |
| H bond acceptor: | 10 |
| H bond donor: | 3 |
| Smile: | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)c3c(nc4ccccc4n3)C(=O)O)C(=O)O)C |
| InChi: | InChI=1S/C18H16N4O6S/c1-18(2)12(17(27)28)22-14(24)11(15(22)29-18)21-13(23)9-10(16(25)26)20-8-6-4-3-5-7(8)19-9/h3-6,11-12,15H,1-2H3,(H,21,23)(H,25,26)(H,27,28)/t11-,12+,15-/m1/s1 |
| InChiKey: | InChIKey=GPMSLJIYNWBYEL-TYNCELHUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.