* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (4-PHENYLOXAZOL-2-YL)METHANOL |
| CAS: | 162537-79-3 |
| English Synonyms: | (4-PHENYLOXAZOL-2-YL)METHANOL |
| MDL Number.: | MFCD16989378 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)c2coc(n2)CO |
| InChi: | InChI=1S/C10H9NO2/c12-6-10-11-9(7-13-10)8-4-2-1-3-5-8/h1-5,7,12H,6H2 |
| InChiKey: | InChIKey=OSCQWZMTHOQKLU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.