* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | HEPTANE-4-THIOL |
CAS: | 1639-06-1 |
English Synonyms: | HEPTANE-4-THIOL ; 4-HEPTANETHIOL |
MDL Number.: | MFCD11193830 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CCCC(CCC)S |
InChi: | InChI=1S/C7H16S/c1-3-5-7(8)6-4-2/h7-8H,3-6H2,1-2H3 |
InChiKey: | InChIKey=OPLGIZOGDFCNCU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.