* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANTHOMEGNIN |
| CAS: | 1685-91-2 |
| English Synonyms: | XANTHOMEGNIN |
| MDL Number.: | MFCD00902622 |
| H bond acceptor: | 12 |
| H bond donor: | 2 |
| Smile: | C[C@@H]1Cc2cc3c(c(c2C(=O)O1)O)C(=O)C(=C(C3=O)OC)C4=C(C(=O)c5cc6c(c(c5C4=O)O)C(=O)O[C@@H](C6)C)OC |
| InChi: | InChI=1S/C30H22O12/c1-9-5-11-7-13-17(23(33)15(11)29(37)41-9)25(35)19(27(39-3)21(13)31)20-26(36)18-14(22(32)28(20)40-4)8-12-6-10(2)42-30(38)16(12)24(18)34/h7-10,33-34H,5-6H2,1-4H3/t9-,10-/m1/s1 |
| InChiKey: | InChIKey=WICHONPZVIYWIJ-NXEZZACHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.