* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-METHYL-3-PENTEN-1-OL |
CAS: | 1708-99-2 |
English Synonyms: | 3-METHYL-3-PENTEN-1-OL |
MDL Number.: | MFCD00039546 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C/C=C(\C)/CCO |
InChi: | InChI=1S/C6H12O/c1-3-6(2)4-5-7/h3,7H,4-5H2,1-2H3/b6-3+ |
InChiKey: | InChIKey=SZPKMIRLEAFMBV-ZZXKWVIFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.