* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,4'-DIMETHOXY-4-AMINOAZOBENZENE |
| CAS: | 17210-48-9 |
| English Synonyms: | 3,4'-DIMETHOXY-4-AMINOAZOBENZENE |
| MDL Number.: | MFCD01675004 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | COc1ccc(cc1)/N=N/c2ccc(c(c2)OC)N |
| InChi: | InChI=1S/C14H15N3O2/c1-18-12-6-3-10(4-7-12)16-17-11-5-8-13(15)14(9-11)19-2/h3-9H,15H2,1-2H3/b17-16+ |
| InChiKey: | InChIKey=KLDSKEKBQNJMCT-WUKNDPDISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.