* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EPIPROGOITRIN |
| CAS: | 19237-18-4 |
| English Synonyms: | EPIPROGOITRIN |
| MDL Number.: | MFCD01725407 |
| H bond acceptor: | 11 |
| H bond donor: | 6 |
| Smile: | C=C[C@H](C/C(=N/OS(=O)(=O)O)/S[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
| InChi: | InChI=1S/C11H19NO10S2/c1-2-5(14)3-7(12-22-24(18,19)20)23-11-10(17)9(16)8(15)6(4-13)21-11/h2,5-6,8-11,13-17H,1,3-4H2,(H,18,19,20)/b12-7-/t5-,6-,8-,9+,10-,11+/m1/s1 |
| InChiKey: | InChIKey=MYHSVHWQEVDFQT-KBHNZSCUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.