* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SUC-PHE-GLY-LEU-BNA |
| CAS: | 202000-07-5 |
| English Synonyms: | SUC-PHE-GLY-LEU-BNA |
| MDL Number.: | MFCD00038777 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | CC(C)C[C@@H](C(=O)Nc1ccc2ccccc2c1)NC(=O)CNC(=O)[C@H](Cc3ccccc3)NC(=O)CCC(=O)O |
| InChi: | InChI=1S/C31H36N4O6/c1-20(2)16-25(31(41)33-24-13-12-22-10-6-7-11-23(22)18-24)35-28(37)19-32-30(40)26(17-21-8-4-3-5-9-21)34-27(36)14-15-29(38)39/h3-13,18,20,25-26H,14-17,19H2,1-2H3,(H,32,40)(H,33,41)(H,34,36)(H,35,37)(H,38,39)/t25-,26-/m0/s1 |
| InChiKey: | InChIKey=QJMBYLVSDVLBAC-UIOOFZCWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.