* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,3,4,5-TETRAHYDRO-2-BUTYL-5-(2-(6-METHYL-3-PYRIDYL)ETHYL)-1H-PYRIDO(4,3-B)INDOLE |
CAS: | 20674-94-6 |
English Synonyms: | 2,3,4,5-TETRAHYDRO-2-BUTYL-5-(2-(6-METHYL-3-PYRIDYL)ETHYL)-1H-PYRIDO(4,3-B)INDOLE |
MDL Number.: | MFCD01690462 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCCCN1CCc2c(c3ccccc3n2CCc4ccc(nc4)C)C1 |
InChi: | InChI=1S/C23H29N3/c1-3-4-13-25-14-12-23-21(17-25)20-7-5-6-8-22(20)26(23)15-11-19-10-9-18(2)24-16-19/h5-10,16H,3-4,11-15,17H2,1-2H3 |
InChiKey: | InChIKey=XIAHJIQQDNEZAT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.