* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (1S)-(2,5-DIMETHOXY-2,5-DIHYDROFURAN-2-YL)ETHANOL |
| CAS: | 236408-20-1 |
| English Synonyms: | (1S)-(2,5-DIMETHOXY-2,5-DIHYDROFURAN-2-YL)ETHANOL |
| MDL Number.: | MFCD01863301 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC([C@@]1(C=CC(O1)OC)OC)O |
| InChi: | InChI=1S/C8H14O4/c1-6(9)8(11-3)5-4-7(10-2)12-8/h4-7,9H,1-3H3/t6?,7?,8-/m0/s1 |
| InChiKey: | InChIKey=OHXZDCYIALCSNL-RRQHEKLDSA-N |
|
|
| Boiling Point: | 72-76 DEG C (1.5MM) |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.