* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | N-Boc-2,5-difluoro-L-phenylalanine |
CAS: | 261165-16-6 |
English Synonyms: | N-BOC-2,5-DIFLUORO-L-PHENYLALANINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)N[C@@H](CC1=C(C=CC(=C1)F)F)C(=O)O |
InChi: | InChI=1S/C14H17F2NO4/c1-14(2,3)21-13(20)17-11(12(18)19)7-8-6-9(15)4-5-10(8)16/h4-6,11H,7H2,1-3H3,(H,17,20)(H,18,19)/t11-/m0/s1 |
InChiKey: | InChIKey=DYSZJZJRRBKIDS-NSHDSACASA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.