* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | BROBACTAM |
CAS: | 26631-90-3 |
English Synonyms: | BROBACTAM |
MDL Number.: | MFCD00869032 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)Br)C(=O)O)C |
InChi: | InChI=1S/C8H10BrNO3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,1-2H3,(H,12,13)/t3-,4+,6-/m1/s1 |
InChiKey: | InChIKey=DAVPSCAAXXVSFU-ALEPSDHESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.