* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,2,4,5-TETRAMETHYL-1,4-CYCLOHEXADIENE |
| CAS: | 26976-92-1 |
| English Synonyms: | 1,2,4,5-TETRAMETHYL-1,4-CYCLOHEXADIENE ; 1,2,4,5-TETRAMETHYL-CYCLOHEXA-1,4-DIENE |
| MDL Number.: | MFCD00010373 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CC1=C(CC(=C(C1)C)C)C |
| InChi: | InChI=1S/C10H16/c1-7-5-9(3)10(4)6-8(7)2/h5-6H2,1-4H3 |
| InChiKey: | InChIKey=GACALPFXAWHEBC-UHFFFAOYSA-N |
|
|
| Comments: | WGK: 3 |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.