* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | NORBORNANE |
| CAS: | 279-23-2 |
| English Synonyms: | BICYCLO[2.2.1]HEPTANE ; NORBORNANE |
| MDL Number.: | MFCD00074822 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | C1C[C@@H]2CC[C@H]1C2 |
| InChi: | InChI=1S/C7H12/c1-2-7-4-3-6(1)5-7/h6-7H,1-5H2/t6-,7+ |
| InChiKey: | InChIKey=UMRZSTCPUPJPOJ-KNVOCYPGSA-N |
|
|
| Melting Point: | 85-88 DEG C(LIT) |
| Comments: | STORAGE TEMPERATURE: 2-8 DEG C UNSPSC: 12352100 WGK: 3 |
|
|
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.