* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SODIUM BUTYRATE-1,2-13C2 |
CAS: | 286367-74-6 |
English Synonyms: | BUTYRIC ACID-1,2-13C2 SODIUM SALT ; SODIUM BUTYRATE-1,2-13C2 |
MDL Number.: | MFCD01075498 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC[13CH2][13C](=O)[O-].[Na+] |
InChi: | InChI=1S/C4H8O2.Na/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);/q;+1/p-1/i3+1,4+1; |
InChiKey: | InChIKey=MFBOGIVSZKQAPD-ZPGUIXIESA-M |
Property |
|
Melting Point: | 250-253 DEG C(LIT) |
Comments: | MASS SHIFT: M+2 WGK: 1 |
Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 112.06 BY ATOM % CALCULATION |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.