* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (2-AMINOETHYL)BORONIC ACID |
| CAS: | 2932-96-9 |
| English Synonyms: | (2-AMINOETHYL)BORONIC ACID |
| MDL Number.: | MFCD16620540 |
| H bond acceptor: | 3 |
| H bond donor: | 3 |
| Smile: | B(CCN)(O)O |
| InChi: | InChI=1S/C2H8BNO2/c4-2-1-3(5)6/h5-6H,1-2,4H2 |
| InChiKey: | InChIKey=CYRNMIDKGLHITL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.