* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TREOSULFAN |
| CAS: | 299-75-2 |
| English Synonyms: | TREOSULFAN |
| MDL Number.: | MFCD01679769 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CS(=O)(=O)OC[C@H]([C@@H](COS(=O)(=O)C)O)O |
| InChi: | InChI=1S/C6H14O8S2/c1-15(9,10)13-3-5(7)6(8)4-14-16(2,11)12/h5-8H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChiKey: | InChIKey=YCPOZVAOBBQLRI-PHDIDXHHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.