* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 2-OXO-2-((3-THIOXO-3H-1,2,4-DITHIAZOL-5-YL)AMINO)ACETATE |
| CAS: | 306980-72-3 |
| English Synonyms: | ETHYL 2-OXO-2-((3-THIOXO-3H-1,2,4-DITHIAZOL-5-YL)AMINO)ACETATE |
| MDL Number.: | MFCD00793643 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)C(=O)Nc1nc(=S)ss1 |
| InChi: | InChI=1S/C6H6N2O3S3/c1-2-11-4(10)3(9)7-5-8-6(12)14-13-5/h2H2,1H3,(H,7,8,9,12) |
| InChiKey: | InChIKey=AREMUTNEVAXQIB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.