* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | D-RIBITOL-5-PHOSPHATE |
| CAS: | 35320-17-3 |
| English Synonyms: | D-RIBITOL-5-PHOSPHATE |
| MDL Number.: | MFCD11974940 |
| H bond acceptor: | 8 |
| H bond donor: | 6 |
| Smile: | C([C@@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)O)O |
| InChi: | InChI=1S/C5H13O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h3-9H,1-2H2,(H2,10,11,12)/t3-,4+,5-/m0/s1 |
| InChiKey: | InChIKey=VJDOAZKNBQCAGE-LMVFSUKVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.