* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-TERT-BUTYL-1,2,4-TRIAZOLIDINE-3,5-DIONE |
| CAS: | 35403-67-9 |
| English Synonyms: | 4-TERT-BUTYL-1,2,4-TRIAZOLIDINE-3,5-DIONE |
| MDL Number.: | MFCD00015466 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)n1c(=O)[nH][nH]c1=O |
| InChi: | InChI=1S/C6H11N3O2/c1-6(2,3)9-4(10)7-8-5(9)11/h1-3H3,(H,7,10)(H,8,11) |
| InChiKey: | InChIKey=OYNMWNWYHCJZHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.