* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AMETHYST VIOLET |
CAS: | 3562-38-7 |
English Synonyms: | AMETHYST VIOLET |
MDL Number.: | MFCD00050076 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCN(CC)c1ccc2c(c1)[n+](c3cc(ccc3n2)N(CC)CC)c4ccccc4.[Cl-] |
InChi: | InChI=1S/C26H31N4.ClH/c1-5-28(6-2)21-14-16-23-25(18-21)30(20-12-10-9-11-13-20)26-19-22(29(7-3)8-4)15-17-24(26)27-23;/h9-19H,5-8H2,1-4H3;1H/q+1;/p-1 |
InChiKey: | InChIKey=OVYHWGDANKJLIW-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.