* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WITHANOLIDE E |
CAS: | 38254-15-8 |
English Synonyms: | WITHANOLIDE E |
MDL Number.: | MFCD09837928 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC1=C(C(=O)O[C@H](C1)[C@@](C)([C@]2(CC[C@@]3([C@@]2(CC[C@H]4[C@H]3C[C@@H]5[C@]6([C@@]4(C(=O)C=CC6)C)O5)C)O)O)O)C |
InChi: | InChI=1S/C28H38O7/c1-15-13-20(34-22(30)16(15)2)25(5,31)28(33)12-11-26(32)18-14-21-27(35-21)9-6-7-19(29)24(27,4)17(18)8-10-23(26,28)3/h6-7,17-18,20-21,31-33H,8-14H2,1-5H3/t17-,18+,20+,21+,23-,24-,25-,26+,27+,28+/m0/s1 |
InChiKey: | InChIKey=RUVPNJSJTWTANE-HBBBROHNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.