* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OKANIN |
CAS: | 484-76-4 |
English Synonyms: | 2',3,3',4,4'-PENTAHYDROXYCHALCONE ; OKANIN ; 2',3',4',3,4-PENTAHYDROXYCHALCONE |
MDL Number.: | MFCD00017392 |
H bond acceptor: | 6 |
H bond donor: | 5 |
Smile: | c1cc(c(cc1/C=C/C(=O)c2ccc(c(c2O)O)O)O)O |
InChi: | InChI=1S/C15H12O6/c16-10(9-3-6-12(18)15(21)14(9)20)4-1-8-2-5-11(17)13(19)7-8/h1-7,17-21H/b4-1+ |
InChiKey: | InChIKey=GSBNFGRTUCCBTK-DAFODLJHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.