* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,9-DICHLORO-1-NONENE |
CAS: | 485320-14-7 |
English Synonyms: | 2,9-DICHLORONON-1-ENE ; 2,9-DICHLORO-1-NONENE |
MDL Number.: | MFCD00671831 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C=C(CCCCCCCCl)Cl |
InChi: | InChI=1S/C9H16Cl2/c1-9(11)7-5-3-2-4-6-8-10/h1-8H2 |
InChiKey: | InChIKey=YOSLDMVBPIVEPQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.