* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (1S,3R,4R,5R)-(-)-3-THUJYLAMINE |
CAS: | 5033-80-7 ;5033-82-9 |
English Synonyms: | (1S,3R,4R,5R)-(-)-3-THUJYLAMINE ; BICYCLO[3.1.0]HEXAN-3-AMINE, 4-METHYL-1-(1-METHYLETHYL)-, [1S-(1ALPHA,3BETA,4BETA,5ALPHA)]- ; 3-THUJYLAMINE, (1S,3R,4R,5R)-(-)- |
MDL Number.: | MFCD17019389 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C[C@H]1[C@H]2C[C@]2(C[C@H]1N)C(C)C |
InChi: | InChI=1S/C10H19N/c1-6(2)10-4-8(10)7(3)9(11)5-10/h6-9H,4-5,11H2,1-3H3/t7-,8+,9+,10-/m0/s1 |
InChiKey: | InChIKey=CDYRVMMLBSIQHS-JLIMGVALSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.