* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XYLOSTASIN |
| CAS: | 50474-67-4 |
| English Synonyms: | XYLOSTACIN ; XYLOSTASIN |
| MDL Number.: | MFCD00079648 |
| H bond acceptor: | 14 |
| H bond donor: | 10 |
| Smile: | C1[C@H]([C@@H]([C@@H]([C@@H]([C@H]1N)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CN)O)O)N)O[C@H]3[C@@H]([C@H]([C@H](O3)CO)O)O)O)N |
| InChi: | InChI=1S/C17H34N4O10/c18-2-6-10(24)12(26)8(21)16(28-6)30-14-5(20)1-4(19)9(23)15(14)31-17-13(27)11(25)7(3-22)29-17/h4-17,22-27H,1-3,18-21H2/t4-,5+,6-,7-,8-,9+,10-,11+,12-,13-,14-,15+,16?,17+/m1/s1 |
| InChiKey: | InChIKey=NSKGQURZWSPSBC-RNIWLRIPSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.