* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,4'-DIFLUORO-2,2'-DINITROBIBENZYL |
CAS: | 50618-92-3 |
English Synonyms: | 4,4'-DIFLUORO-2,2'-DINITROBIBENZYL |
MDL Number.: | MFCD00007201 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | c1cc(c(cc1F)[N+](=O)[O-])CCc2ccc(cc2[N+](=O)[O-])F |
InChi: | InChI=1S/C14H10F2N2O4/c15-11-5-3-9(13(7-11)17(19)20)1-2-10-4-6-12(16)8-14(10)18(21)22/h3-8H,1-2H2 |
InChiKey: | InChIKey=NRDWMCMPPQKQMY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.