* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4-METHYL-2H,3H-FURO[2,3-B]PYRIDIN-3-ONE |
CAS: | 50839-99-1 |
English Synonyms: | 4-METHYL-FURO[2,3-B]PYRIDIN-3-ONE ; 4-METHYL-2H,3H-FURO[2,3-B]PYRIDIN-3-ONE |
MDL Number.: | MFCD18074072 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | Cc1ccnc2c1C(=O)CO2 |
InChi: | InChI=1S/C8H7NO2/c1-5-2-3-9-8-7(5)6(10)4-11-8/h2-3H,4H2,1H3 |
InChiKey: | InChIKey=NGIHNXQMYNMZDG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.