* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-METHYL-2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL |
CAS: | 517864-13-0 |
English Synonyms: | 5-METHYL-2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL ; PHENOL, 5-METHYL-2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)- |
MDL Number.: | MFCD16994281 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(cc2O)C |
InChi: | InChI=1S/C13H19BO3/c1-9-6-7-10(11(15)8-9)14-16-12(2,3)13(4,5)17-14/h6-8,15H,1-5H3 |
InChiKey: | InChIKey=KKNJXLDMVHWJGM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.