* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-ETHYLOXIRAN-2-ONE |
CAS: | 52287-99-7 |
English Synonyms: | 3-ETHYLOXIRAN-2-ONE |
MDL Number.: | MFCD01318899 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC1C(=O)O1 |
InChi: | InChI=1S/C4H6O2/c1-2-3-4(5)6-3/h3H,2H2,1H3 |
InChiKey: | InChIKey=ZOMPBXWFMAJRRU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.