* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | EPOXYFARNESOL |
CAS: | 5233-99-8 |
English Synonyms: | EPOXYFARNESOL ; (2E,6E)-9-(3,3-DIMETHYL-2-OXIRANYL)-3,7-DIMETHYL-2,6-NONADIEN-1-OL |
MDL Number.: | MFCD18253446 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C(=C\CC/C(=C/CO)/C)/CCC1C(O1)(C)C |
InChi: | InChI=1S/C15H26O2/c1-12(6-5-7-13(2)10-11-16)8-9-14-15(3,4)17-14/h6,10,14,16H,5,7-9,11H2,1-4H3/b12-6+,13-10+ |
InChiKey: | InChIKey=IVSNYPKSUNPKHJ-WAAHFECUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.