* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1H-ISOINDOL-5-OL, OCTAHYDRO-, (3AR,5S,7AS)-REL- |
CAS: | 52865-08-4 |
English Synonyms: | 1H-ISOINDOL-5-OL, OCTAHYDRO-, (3AR,5S,7AS)-REL- |
MDL Number.: | MFCD18071924 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C1C[C@@H]2CNC[C@@H]2C[C@H]1O |
InChi: | InChI=1S/C8H15NO/c10-8-2-1-6-4-9-5-7(6)3-8/h6-10H,1-5H2/t6-,7+,8+/m1/s1 |
InChiKey: | InChIKey=DPOLLBMYIRHSRA-CSMHCCOUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.