* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,7,8-OCTANETETROL |
CAS: | 52894-25-4 |
English Synonyms: | OCTANE-1,2,7,8-TETROL ; 1,2,7,8-OCTANETETROL ; OCTANE-1,2,7,8-TETRAOL |
MDL Number.: | MFCD00011720 |
H bond acceptor: | 4 |
H bond donor: | 4 |
Smile: | C(CCC(CO)O)CC(CO)O |
InChi: | InChI=1S/C8H18O4/c9-5-7(11)3-1-2-4-8(12)6-10/h7-12H,1-6H2 |
InChiKey: | InChIKey=TZSZOUXLMCRLSU-UHFFFAOYSA-N |
Property |
|
Melting Point: | 82-85 DEG C |
Comments: | UNSPSC: 12352100 WGK: 3 |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.